5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine
Modify Date: 2026-07-27 17:49:40
![5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine Structure](https://www.chemsrc.com/extcaspic/259/2138021-41-5.png)
5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine structure
|
Common Name | 5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine | ||
|---|---|---|---|---|
| CAS Number | 2138021-41-5 | Molecular Weight | 295.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClF4N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10ClF4N3 |
|---|---|
| Molecular Weight | 295.66 |
| InChIKey | VUMTZQHTIXBIDW-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(Cl)n2nc(C(F)(F)C(F)F)nc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine? |
| A: Molecular formula of 5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine is C11H10ClF4N3. |
| Q: What is the English name of 5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine? |
| A: The English name of 5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine is 5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine. |
| Q: What is the CAS number of 5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine? |
| A: CAS number of 5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine is 2138021-41-5. |
| Q: What is the SMILES notation of 5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine? |
| A: SMILES notation of 5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine is CC(C)c1cc(Cl)n2nc(C(F)(F)C(F)F)nc2c1. |
| Q: What is the molecular weight of 5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine? |
| A: Molecular weight of 5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine is 295.66. |
| Q: What is the InChIKey of 5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine? |
| A: InChIKey of 5-Chloro-7-(propan-2-yl)-2-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine is VUMTZQHTIXBIDW-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2138021-41-5? |
| A: Chinese name of 2138021-41-5 is 2138021-41-5. |