bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol
Modify Date: 2026-07-14 06:44:10
bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol structure
|
Common Name | bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol | ||
|---|---|---|---|---|
| CAS Number | 2138029-86-2 | Molecular Weight | 241.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H23N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H23N3S |
|---|---|
| Molecular Weight | 241.40 |
| InChIKey | BEAXLXTUVTUEEM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Cc1n[nH]c(=S)n1CC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol? |
| A: SMILES notation of bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol is CC(C)(C)Cc1n[nH]c(=S)n1CC(C)(C)C. |
| Q: What is the Chinese name of 2138029-86-2? |
| A: Chinese name of 2138029-86-2 is 2138029-86-2. |
| Q: What is the molecular formula of bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol? |
| A: Molecular formula of bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol is C12H23N3S. |
| Q: What is the English name of bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol? |
| A: The English name of bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol is bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol. |
| Q: What is the molecular weight of bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol? |
| A: Molecular weight of bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol is 241.40. |
| Q: What is the CAS number of bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol? |
| A: CAS number of bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol is 2138029-86-2. |
| Q: What is the InChIKey of bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol? |
| A: InChIKey of bis(2,2-dimethylpropyl)-4H-1,2,4-triazole-3-thiol is BEAXLXTUVTUEEM-UHFFFAOYSA-N. |