2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane
Modify Date: 2026-08-24 16:08:58
2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane structure
|
Common Name | 2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane | ||
|---|---|---|---|---|
| CAS Number | 2138038-78-3 | Molecular Weight | 299.97 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H11BrCl2F2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H11BrCl2F2O |
|---|---|
| Molecular Weight | 299.97 |
| InChIKey | HNWPJJJJQMDVQK-UHFFFAOYSA-N |
| SMILES | CC(F)(F)COC(CCl)C(Br)CCl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane? |
| A: InChIKey of 2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane is HNWPJJJJQMDVQK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane? |
| A: Molecular weight of 2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane is 299.97. |
| Q: What is the molecular formula of 2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane? |
| A: Molecular formula of 2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane is C7H11BrCl2F2O. |
| Q: What is the SMILES notation of 2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane? |
| A: SMILES notation of 2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane is CC(F)(F)COC(CCl)C(Br)CCl. |
| Q: What is the Chinese name of 2138038-78-3? |
| A: Chinese name of 2138038-78-3 is 2138038-78-3. |
| Q: What is the English name of 2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane? |
| A: The English name of 2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane is 2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane. |
| Q: What is the CAS number of 2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane? |
| A: CAS number of 2-Bromo-1,4-dichloro-3-(2,2-difluoropropoxy)butane is 2138038-78-3. |