Sodium 3,5-dibromobenzene-1-sulfinate structure
|
Common Name | Sodium 3,5-dibromobenzene-1-sulfinate | ||
|---|---|---|---|---|
| CAS Number | 2138125-75-2 | Molecular Weight | 321.95 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3Br2NaO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sodium 3,5-dibromobenzene-1-sulfinate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H3Br2NaO2S |
|---|---|
| Molecular Weight | 321.95 |
| InChIKey | LTWPROIYLJUOOQ-UHFFFAOYSA-M |
| SMILES | O=S([O-])c1cc(Br)cc(Br)c1.[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Sodium 3,5-dibromobenzene-1-sulfinate? |
| A: SMILES notation of Sodium 3,5-dibromobenzene-1-sulfinate is O=S([O-])c1cc(Br)cc(Br)c1.[Na+]. |
| Q: What is the molecular formula of Sodium 3,5-dibromobenzene-1-sulfinate? |
| A: Molecular formula of Sodium 3,5-dibromobenzene-1-sulfinate is C6H3Br2NaO2S. |
| Q: What is the English name of Sodium 3,5-dibromobenzene-1-sulfinate? |
| A: The English name of Sodium 3,5-dibromobenzene-1-sulfinate is Sodium 3,5-dibromobenzene-1-sulfinate. |
| Q: What is the CAS number of Sodium 3,5-dibromobenzene-1-sulfinate? |
| A: CAS number of Sodium 3,5-dibromobenzene-1-sulfinate is 2138125-75-2. |
| Q: What is the InChIKey of Sodium 3,5-dibromobenzene-1-sulfinate? |
| A: InChIKey of Sodium 3,5-dibromobenzene-1-sulfinate is LTWPROIYLJUOOQ-UHFFFAOYSA-M. |
| Q: What is the Chinese name of 2138125-75-2? |
| A: Chinese name of 2138125-75-2 is 2138125-75-2. |
| Q: What is the molecular weight of Sodium 3,5-dibromobenzene-1-sulfinate? |
| A: Molecular weight of Sodium 3,5-dibromobenzene-1-sulfinate is 321.95. |