{1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol
Modify Date: 2025-08-27 17:42:09
![{1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol Structure](https://www.chemsrc.com/extcaspic/271/2138140-25-5.png)
{1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol structure
|
Common Name | {1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol | ||
|---|---|---|---|---|
| CAS Number | 2138140-25-5 | Molecular Weight | 260.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16N2O2S2 |
|---|---|
| Molecular Weight | 260.4 |
| InChIKey | SIQRHBXVKYGKIS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1cnn(CC2(CS)CCC2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of {1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol? |
| A: SMILES notation of {1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol is CS(=O)(=O)c1cnn(CC2(CS)CCC2)c1. |
| Q: What is the English name of {1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol? |
| A: The English name of {1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol is {1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol. |
| Q: What is the CAS number of {1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol? |
| A: CAS number of {1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol is 2138140-25-5. |
| Q: What is the molecular weight of {1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol? |
| A: Molecular weight of {1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol is 260.4. |
| Q: What is the InChIKey of {1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol? |
| A: InChIKey of {1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol is SIQRHBXVKYGKIS-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2138140-25-5? |
| A: Chinese name of 2138140-25-5 is 2138140-25-5. |
| Q: What is the molecular formula of {1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol? |
| A: Molecular formula of {1-[(4-methanesulfonyl-1H-pyrazol-1-yl)methyl]cyclobutyl}methanethiol is C10H16N2O2S2. |