8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione
Modify Date: 2025-09-08 21:34:04
8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione structure
|
Common Name | 8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione | ||
|---|---|---|---|---|
| CAS Number | 2138151-81-0 | Molecular Weight | 242.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11FO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11FO3S |
|---|---|
| Molecular Weight | 242.27 |
| InChIKey | XTJZKZBZVTVBPU-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)c2cccc(F)c2S1(=O)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2138151-81-0? |
| A: Chinese name of 2138151-81-0 is 2138151-81-0. |
| Q: What is the English name of 8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione? |
| A: The English name of 8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione is 8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione. |
| Q: What is the molecular formula of 8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione? |
| A: Molecular formula of 8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione is C11H11FO3S. |
| Q: What is the SMILES notation of 8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione? |
| A: SMILES notation of 8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione is CC1(C)CC(=O)c2cccc(F)c2S1(=O)=O. |
| Q: What is the molecular weight of 8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione? |
| A: Molecular weight of 8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione is 242.27. |
| Q: What is the CAS number of 8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione? |
| A: CAS number of 8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione is 2138151-81-0. |
| Q: What is the InChIKey of 8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione? |
| A: InChIKey of 8-fluoro-2,2-dimethyl-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione is XTJZKZBZVTVBPU-UHFFFAOYSA-N. |