4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid
Modify Date: 2025-09-17 16:24:59
![4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid Structure](https://www.chemsrc.com/extcaspic/100/2138157-89-6.png)
4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid structure
|
Common Name | 4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2138157-89-6 | Molecular Weight | 431.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H25NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H25NO5 |
|---|---|
| Molecular Weight | 431.5 |
| InChIKey | BHQOJRWELVJVRY-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCOc1ccc(CNC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid? |
| A: Molecular weight of 4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid is 431.5. |
| Q: What is the English name of 4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid? |
| A: The English name of 4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid is 4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid. |
| Q: What is the CAS number of 4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid? |
| A: CAS number of 4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid is 2138157-89-6. |
| Q: What is the SMILES notation of 4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid? |
| A: SMILES notation of 4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid is O=C(O)CCCOc1ccc(CNC(=O)OCC2c3ccccc3-c3ccccc32)cc1. |
| Q: What is the molecular formula of 4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid? |
| A: Molecular formula of 4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid is C26H25NO5. |
| Q: What is the InChIKey of 4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid? |
| A: InChIKey of 4-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenoxy}butanoic acid is BHQOJRWELVJVRY-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2138157-89-6? |
| A: Chinese name of 2138157-89-6 is 2138157-89-6. |