5-[(2,2-Difluorocyclopentyl)methyl]-1,2,3,6-tetrahydropyridin-3-ol structure
|
Common Name | 5-[(2,2-Difluorocyclopentyl)methyl]-1,2,3,6-tetrahydropyridin-3-ol | ||
|---|---|---|---|---|
| CAS Number | 2138159-75-6 | Molecular Weight | 217.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17F2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[(2,2-Difluorocyclopentyl)methyl]-1,2,3,6-tetrahydropyridin-3-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H17F2NO |
|---|---|
| Molecular Weight | 217.26 |
| InChIKey | MRSANDBDJNJHAC-UHFFFAOYSA-N |
| SMILES | OC1C=C(CC2CCCC2(F)F)CNC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5-[(2,2-Difluorocyclopentyl)methyl]-1,2,3,6-tetrahydropyridin-3-ol? |
| A: CAS number of 5-[(2,2-Difluorocyclopentyl)methyl]-1,2,3,6-tetrahydropyridin-3-ol is 2138159-75-6. |
| Q: What is the Chinese name of 2138159-75-6? |
| A: Chinese name of 2138159-75-6 is 2138159-75-6. |
| Q: What is the SMILES notation of 5-[(2,2-Difluorocyclopentyl)methyl]-1,2,3,6-tetrahydropyridin-3-ol? |
| A: SMILES notation of 5-[(2,2-Difluorocyclopentyl)methyl]-1,2,3,6-tetrahydropyridin-3-ol is OC1C=C(CC2CCCC2(F)F)CNC1. |
| Q: What is the English name of 5-[(2,2-Difluorocyclopentyl)methyl]-1,2,3,6-tetrahydropyridin-3-ol? |
| A: The English name of 5-[(2,2-Difluorocyclopentyl)methyl]-1,2,3,6-tetrahydropyridin-3-ol is 5-[(2,2-Difluorocyclopentyl)methyl]-1,2,3,6-tetrahydropyridin-3-ol. |
| Q: What is the molecular formula of 5-[(2,2-Difluorocyclopentyl)methyl]-1,2,3,6-tetrahydropyridin-3-ol? |
| A: Molecular formula of 5-[(2,2-Difluorocyclopentyl)methyl]-1,2,3,6-tetrahydropyridin-3-ol is C11H17F2NO. |
| Q: What is the InChIKey of 5-[(2,2-Difluorocyclopentyl)methyl]-1,2,3,6-tetrahydropyridin-3-ol? |
| A: InChIKey of 5-[(2,2-Difluorocyclopentyl)methyl]-1,2,3,6-tetrahydropyridin-3-ol is MRSANDBDJNJHAC-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-[(2,2-Difluorocyclopentyl)methyl]-1,2,3,6-tetrahydropyridin-3-ol? |
| A: Molecular weight of 5-[(2,2-Difluorocyclopentyl)methyl]-1,2,3,6-tetrahydropyridin-3-ol is 217.26. |