4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride
Modify Date: 2025-09-02 19:28:53
4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride structure
|
Common Name | 4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 2138159-95-0 | Molecular Weight | 219.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H10FN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H10FN3O2S |
|---|---|
| Molecular Weight | 219.24 |
| InChIKey | YLEJOVUHVVUPFD-UHFFFAOYSA-N |
| SMILES | CCc1nnc(S(=O)(=O)F)n1C1CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride? |
| A: Molecular weight of 4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride is 219.24. |
| Q: What is the CAS number of 4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride? |
| A: CAS number of 4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride is 2138159-95-0. |
| Q: What is the InChIKey of 4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride? |
| A: InChIKey of 4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride is YLEJOVUHVVUPFD-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride? |
| A: Molecular formula of 4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride is C7H10FN3O2S. |
| Q: What is the SMILES notation of 4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride? |
| A: SMILES notation of 4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride is CCc1nnc(S(=O)(=O)F)n1C1CC1. |
| Q: What is the Chinese name of 2138159-95-0? |
| A: Chinese name of 2138159-95-0 is 2138159-95-0. |
| Q: What is the English name of 4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride? |
| A: The English name of 4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride is 4-cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-sulfonyl fluoride. |