N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine
Modify Date: 2026-07-02 11:31:11
N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine structure
|
Common Name | N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 2138175-66-1 | Molecular Weight | 245.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19N3O |
|---|---|
| Molecular Weight | 245.32 |
| InChIKey | LBWVRBDPHUQGMM-UHFFFAOYSA-N |
| SMILES | CCNc1c(N)cnc2c(CCOC)cccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2138175-66-1? |
| A: Chinese name of 2138175-66-1 is 2138175-66-1. |
| Q: What is the molecular weight of N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine? |
| A: Molecular weight of N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine is 245.32. |
| Q: What is the CAS number of N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine? |
| A: CAS number of N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine is 2138175-66-1. |
| Q: What is the English name of N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine? |
| A: The English name of N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine is N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine. |
| Q: What is the molecular formula of N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine? |
| A: Molecular formula of N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine is C14H19N3O. |
| Q: What is the InChIKey of N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine? |
| A: InChIKey of N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine is LBWVRBDPHUQGMM-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine? |
| A: SMILES notation of N4-ethyl-8-(2-methoxyethyl)quinoline-3,4-diamine is CCNc1c(N)cnc2c(CCOC)cccc12. |