2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid
Modify Date: 2026-08-06 11:42:46
![2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid Structure](https://www.chemsrc.com/extcaspic/315/2138178-18-2.png)
2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid structure
|
Common Name | 2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2138178-18-2 | Molecular Weight | 280.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9FO5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9FO5S2 |
|---|---|
| Molecular Weight | 280.3 |
| InChIKey | BWVFRDDVRZEDDR-UHFFFAOYSA-N |
| SMILES | O=C(O)CC1OCCc2sc(S(=O)(=O)F)cc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid? |
| A: The English name of 2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid is 2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid. |
| Q: What is the CAS number of 2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid? |
| A: CAS number of 2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid is 2138178-18-2. |
| Q: What is the molecular weight of 2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid? |
| A: Molecular weight of 2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid is 280.3. |
| Q: What is the Chinese name of 2138178-18-2? |
| A: Chinese name of 2138178-18-2 is 2138178-18-2. |
| Q: What is the InChIKey of 2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid? |
| A: InChIKey of 2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid is BWVFRDDVRZEDDR-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid? |
| A: SMILES notation of 2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid is O=C(O)CC1OCCc2sc(S(=O)(=O)F)cc21. |
| Q: What is the molecular formula of 2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid? |
| A: Molecular formula of 2-[2-(fluorosulfonyl)-4H,6H,7H-thieno[3,2-c]pyran-4-yl]acetic acid is C9H9FO5S2. |