1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one
Modify Date: 2025-10-12 12:18:12
![1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one Structure](https://www.chemsrc.com/extcaspic/193/2138185-41-6.png)
1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one structure
|
Common Name | 1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one | ||
|---|---|---|---|---|
| CAS Number | 2138185-41-6 | Molecular Weight | 238.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H26N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H26N2O |
|---|---|
| Molecular Weight | 238.37 |
| InChIKey | GDPYWAFSBVJHPQ-UHFFFAOYSA-N |
| SMILES | CCCN1CCC2(CC1)C(=O)CCN2CCC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one? |
| A: InChIKey of 1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one is GDPYWAFSBVJHPQ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one? |
| A: Molecular formula of 1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one is C14H26N2O. |
| Q: What is the SMILES notation of 1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one? |
| A: SMILES notation of 1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one is CCCN1CCC2(CC1)C(=O)CCN2CCC. |
| Q: What is the CAS number of 1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one? |
| A: CAS number of 1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one is 2138185-41-6. |
| Q: What is the molecular weight of 1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one? |
| A: Molecular weight of 1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one is 238.37. |
| Q: What is the Chinese name of 2138185-41-6? |
| A: Chinese name of 2138185-41-6 is 2138185-41-6. |
| Q: What is the English name of 1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one? |
| A: The English name of 1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one is 1,8-Dipropyl-1,8-diazaspiro[4.5]decan-4-one. |