3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine
Modify Date: 2025-08-25 22:30:28
![3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine Structure](https://www.chemsrc.com/extcaspic/193/2138188-84-6.png)
3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine structure
|
Common Name | 3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 2138188-84-6 | Molecular Weight | 205.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15N3O |
|---|---|
| Molecular Weight | 205.26 |
| InChIKey | PSSIMUOKBLFEDF-UHFFFAOYSA-N |
| SMILES | CCc1noc2nc(C(C)C)cc(N)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine? |
| A: Molecular weight of 3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine is 205.26. |
| Q: What is the CAS number of 3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine? |
| A: CAS number of 3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine is 2138188-84-6. |
| Q: What is the InChIKey of 3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine? |
| A: InChIKey of 3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine is PSSIMUOKBLFEDF-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2138188-84-6? |
| A: Chinese name of 2138188-84-6 is 2138188-84-6. |
| Q: What is the English name of 3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine? |
| A: The English name of 3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine is 3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine. |
| Q: What is the molecular formula of 3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine? |
| A: Molecular formula of 3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine is C11H15N3O. |
| Q: What is the SMILES notation of 3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine? |
| A: SMILES notation of 3-Ethyl-6-(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridin-4-amine is CCc1noc2nc(C(C)C)cc(N)c12. |