Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate
Modify Date: 2026-06-30 20:02:55
![Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate Structure](https://www.chemsrc.com/extcaspic/254/2138195-44-3.png)
Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate structure
|
Common Name | Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate | ||
|---|---|---|---|---|
| CAS Number | 2138195-44-3 | Molecular Weight | 299.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H5F3NNaO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H5F3NNaO3S |
|---|---|
| Molecular Weight | 299.20 |
| InChIKey | WUOBWYFWZZZNFQ-UHFFFAOYSA-M |
| SMILES | O=S([O-])c1cc(-c2ccc(C(F)(F)F)cc2)no1.[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate? |
| A: Molecular weight of Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate is 299.20. |
| Q: What is the Chinese name of 2138195-44-3? |
| A: Chinese name of 2138195-44-3 is 2138195-44-3. |
| Q: What is the molecular formula of Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate? |
| A: Molecular formula of Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate is C10H5F3NNaO3S. |
| Q: What is the InChIKey of Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate? |
| A: InChIKey of Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate is WUOBWYFWZZZNFQ-UHFFFAOYSA-M. |
| Q: What is the CAS number of Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate? |
| A: CAS number of Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate is 2138195-44-3. |
| Q: What is the SMILES notation of Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate? |
| A: SMILES notation of Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate is O=S([O-])c1cc(-c2ccc(C(F)(F)F)cc2)no1.[Na+]. |
| Q: What is the English name of Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate? |
| A: The English name of Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate is Sodium 3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-sulfinate. |