8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride
Modify Date: 2026-08-06 18:17:06
8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride structure
|
Common Name | 8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 2138210-25-8 | Molecular Weight | 324.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7BrFNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7BrFNO4S |
|---|---|
| Molecular Weight | 324.13 |
| InChIKey | JDFJOKRFLDKHEE-UHFFFAOYSA-N |
| SMILES | O=C1NCCOc2cc(Br)c(S(=O)(=O)F)cc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride? |
| A: The English name of 8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride is 8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride. |
| Q: What is the SMILES notation of 8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride? |
| A: SMILES notation of 8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride is O=C1NCCOc2cc(Br)c(S(=O)(=O)F)cc21. |
| Q: What is the molecular formula of 8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride? |
| A: Molecular formula of 8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride is C9H7BrFNO4S. |
| Q: What is the molecular weight of 8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride? |
| A: Molecular weight of 8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride is 324.13. |
| Q: What is the InChIKey of 8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride? |
| A: InChIKey of 8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride is JDFJOKRFLDKHEE-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2138210-25-8? |
| A: Chinese name of 2138210-25-8 is 2138210-25-8. |
| Q: What is the CAS number of 8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride? |
| A: CAS number of 8-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl fluoride is 2138210-25-8. |