4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione
Modify Date: 2025-10-06 10:41:56
![4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione Structure](https://www.chemsrc.com/extcaspic/385/2138227-67-3.png)
4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione structure
|
Common Name | 4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione | ||
|---|---|---|---|---|
| CAS Number | 2138227-67-3 | Molecular Weight | 307.80 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18ClN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H18ClN3O3S |
|---|---|
| Molecular Weight | 307.80 |
| InChIKey | NGORSMKTCDEPGO-UHFFFAOYSA-N |
| SMILES | O=S1(=O)CCC(OCCn2cc(CCCl)nn2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione? |
| A: CAS number of 4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione is 2138227-67-3. |
| Q: What is the molecular weight of 4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione? |
| A: Molecular weight of 4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione is 307.80. |
| Q: What is the SMILES notation of 4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione? |
| A: SMILES notation of 4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione is O=S1(=O)CCC(OCCn2cc(CCCl)nn2)CC1. |
| Q: What is the English name of 4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione? |
| A: The English name of 4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione is 4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione. |
| Q: What is the InChIKey of 4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione? |
| A: InChIKey of 4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione is NGORSMKTCDEPGO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione? |
| A: Molecular formula of 4-{2-[4-(2-chloroethyl)-1H-1,2,3-triazol-1-yl]ethoxy}-1lambda6-thiane-1,1-dione is C11H18ClN3O3S. |
| Q: What is the Chinese name of 2138227-67-3? |
| A: Chinese name of 2138227-67-3 is 2138227-67-3. |