2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride
Modify Date: 2026-07-27 14:57:28
2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride structure
|
Common Name | 2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 2138229-71-5 | Molecular Weight | 247.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H2Cl2F2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H2Cl2F2O2S |
|---|---|
| Molecular Weight | 247.05 |
| InChIKey | MHJDWIYGTPERSI-UHFFFAOYSA-N |
| SMILES | O=S(=O)(F)c1ccc(Cl)c(F)c1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride? |
| A: InChIKey of 2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride is MHJDWIYGTPERSI-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride? |
| A: CAS number of 2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride is 2138229-71-5. |
| Q: What is the molecular weight of 2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride? |
| A: Molecular weight of 2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride is 247.05. |
| Q: What is the SMILES notation of 2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride? |
| A: SMILES notation of 2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride is O=S(=O)(F)c1ccc(Cl)c(F)c1Cl. |
| Q: What is the English name of 2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride? |
| A: The English name of 2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride is 2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride. |
| Q: What is the Chinese name of 2138229-71-5? |
| A: Chinese name of 2138229-71-5 is 2138229-71-5. |
| Q: What is the molecular formula of 2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride? |
| A: Molecular formula of 2,4-Dichloro-3-fluorobenzene-1-sulfonyl fluoride is C6H2Cl2F2O2S. |