Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate
Modify Date: 2026-09-28 12:10:38
Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate structure
|
Common Name | Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate | ||
|---|---|---|---|---|
| CAS Number | 2138236-38-9 | Molecular Weight | 263.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14NNaO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14NNaO3S |
|---|---|
| Molecular Weight | 263.29 |
| InChIKey | VNBAITYQQHHUDS-UHFFFAOYSA-M |
| SMILES | CC(C)(C)C(=O)Nc1ccc(S(=O)[O-])cc1.[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate? |
| A: CAS number of Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate is 2138236-38-9. |
| Q: What is the molecular weight of Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate? |
| A: Molecular weight of Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate is 263.29. |
| Q: What is the Chinese name of 2138236-38-9? |
| A: Chinese name of 2138236-38-9 is 2138236-38-9. |
| Q: What is the InChIKey of Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate? |
| A: InChIKey of Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate is VNBAITYQQHHUDS-UHFFFAOYSA-M. |
| Q: What is the SMILES notation of Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate? |
| A: SMILES notation of Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate is CC(C)(C)C(=O)Nc1ccc(S(=O)[O-])cc1.[Na+]. |
| Q: What is the English name of Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate? |
| A: The English name of Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate is Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate. |
| Q: What is the molecular formula of Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate? |
| A: Molecular formula of Sodium 4-(2,2-dimethylpropanamido)benzene-1-sulfinate is C11H14NNaO3S. |