Sodium dichloro-1,3-thiazole-5-sulfinate
Modify Date: 2026-07-12 16:52:52
Sodium dichloro-1,3-thiazole-5-sulfinate structure
|
Common Name | Sodium dichloro-1,3-thiazole-5-sulfinate | ||
|---|---|---|---|---|
| CAS Number | 2138237-19-9 | Molecular Weight | 240.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3Cl2NNaO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sodium dichloro-1,3-thiazole-5-sulfinate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C3Cl2NNaO2S2 |
|---|---|
| Molecular Weight | 240.1 |
| InChIKey | KLRXSCFVSGLKGT-UHFFFAOYSA-M |
| SMILES | O=S([O-])c1sc(Cl)nc1Cl.[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Sodium dichloro-1,3-thiazole-5-sulfinate? |
| A: Molecular weight of Sodium dichloro-1,3-thiazole-5-sulfinate is 240.1. |
| Q: What is the CAS number of Sodium dichloro-1,3-thiazole-5-sulfinate? |
| A: CAS number of Sodium dichloro-1,3-thiazole-5-sulfinate is 2138237-19-9. |
| Q: What is the molecular formula of Sodium dichloro-1,3-thiazole-5-sulfinate? |
| A: Molecular formula of Sodium dichloro-1,3-thiazole-5-sulfinate is C3Cl2NNaO2S2. |
| Q: What is the InChIKey of Sodium dichloro-1,3-thiazole-5-sulfinate? |
| A: InChIKey of Sodium dichloro-1,3-thiazole-5-sulfinate is KLRXSCFVSGLKGT-UHFFFAOYSA-M. |
| Q: What is the Chinese name of 2138237-19-9? |
| A: Chinese name of 2138237-19-9 is 2138237-19-9. |
| Q: What is the English name of Sodium dichloro-1,3-thiazole-5-sulfinate? |
| A: The English name of Sodium dichloro-1,3-thiazole-5-sulfinate is Sodium dichloro-1,3-thiazole-5-sulfinate. |
| Q: What is the SMILES notation of Sodium dichloro-1,3-thiazole-5-sulfinate? |
| A: SMILES notation of Sodium dichloro-1,3-thiazole-5-sulfinate is O=S([O-])c1sc(Cl)nc1Cl.[Na+]. |