N-ethyl-2,6-dimethoxypyridine-3-sulfonamide
Modify Date: 2026-07-16 17:40:56
N-ethyl-2,6-dimethoxypyridine-3-sulfonamide structure
|
Common Name | N-ethyl-2,6-dimethoxypyridine-3-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 2138237-66-6 | Molecular Weight | 246.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-ethyl-2,6-dimethoxypyridine-3-sulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14N2O4S |
|---|---|
| Molecular Weight | 246.29 |
| InChIKey | OSGDFAUANSULGV-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)c1ccc(OC)nc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-ethyl-2,6-dimethoxypyridine-3-sulfonamide? |
| A: Molecular formula of N-ethyl-2,6-dimethoxypyridine-3-sulfonamide is C9H14N2O4S. |
| Q: What is the SMILES notation of N-ethyl-2,6-dimethoxypyridine-3-sulfonamide? |
| A: SMILES notation of N-ethyl-2,6-dimethoxypyridine-3-sulfonamide is CCNS(=O)(=O)c1ccc(OC)nc1OC. |
| Q: What is the InChIKey of N-ethyl-2,6-dimethoxypyridine-3-sulfonamide? |
| A: InChIKey of N-ethyl-2,6-dimethoxypyridine-3-sulfonamide is OSGDFAUANSULGV-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2138237-66-6? |
| A: Chinese name of 2138237-66-6 is 2138237-66-6. |
| Q: What is the English name of N-ethyl-2,6-dimethoxypyridine-3-sulfonamide? |
| A: The English name of N-ethyl-2,6-dimethoxypyridine-3-sulfonamide is N-ethyl-2,6-dimethoxypyridine-3-sulfonamide. |
| Q: What is the CAS number of N-ethyl-2,6-dimethoxypyridine-3-sulfonamide? |
| A: CAS number of N-ethyl-2,6-dimethoxypyridine-3-sulfonamide is 2138237-66-6. |
| Q: What is the molecular weight of N-ethyl-2,6-dimethoxypyridine-3-sulfonamide? |
| A: Molecular weight of N-ethyl-2,6-dimethoxypyridine-3-sulfonamide is 246.29. |