Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate
Modify Date: 2025-09-23 20:37:42
Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate structure
|
Common Name | Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate | ||
|---|---|---|---|---|
| CAS Number | 2138237-72-4 | Molecular Weight | 220.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14F2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14F2O3 |
|---|---|
| Molecular Weight | 220.21 |
| InChIKey | CQJOFXVAVYOXCW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(O)C1=CCC(F)(F)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate? |
| A: CAS number of Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate is 2138237-72-4. |
| Q: What is the English name of Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate? |
| A: The English name of Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate is Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate. |
| Q: What is the SMILES notation of Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate? |
| A: SMILES notation of Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate is CCOC(=O)C(O)C1=CCC(F)(F)CC1. |
| Q: What is the Chinese name of 2138237-72-4? |
| A: Chinese name of 2138237-72-4 is 2138237-72-4. |
| Q: What is the molecular weight of Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate? |
| A: Molecular weight of Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate is 220.21. |
| Q: What is the molecular formula of Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate? |
| A: Molecular formula of Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate is C10H14F2O3. |
| Q: What is the InChIKey of Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate? |
| A: InChIKey of Ethyl 2-(4,4-difluorocyclohex-1-en-1-yl)-2-hydroxyacetate is CQJOFXVAVYOXCW-UHFFFAOYSA-N. |