ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate
Modify Date: 2026-08-22 09:42:48
ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate structure
|
Common Name | ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2138250-82-3 | Molecular Weight | 269.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H23N3O3 |
|---|---|
| Molecular Weight | 269.34 |
| InChIKey | KFGSCNYBXLBION-UHFFFAOYSA-N |
| SMILES | CCCCn1nc(C(=O)OCC)c(CCOC)c1N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate? |
| A: InChIKey of ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate is KFGSCNYBXLBION-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2138250-82-3? |
| A: Chinese name of 2138250-82-3 is 2138250-82-3. |
| Q: What is the CAS number of ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate? |
| A: CAS number of ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate is 2138250-82-3. |
| Q: What is the English name of ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate? |
| A: The English name of ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate is ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate. |
| Q: What is the molecular weight of ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate? |
| A: Molecular weight of ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate is 269.34. |
| Q: What is the molecular formula of ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate? |
| A: Molecular formula of ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate is C13H23N3O3. |
| Q: What is the SMILES notation of ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate? |
| A: SMILES notation of ethyl 5-amino-1-butyl-4-(2-methoxyethyl)-1H-pyrazole-3-carboxylate is CCCCn1nc(C(=O)OCC)c(CCOC)c1N. |