N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide
Modify Date: 2025-08-27 19:56:07
![N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide Structure](https://www.chemsrc.com/extcaspic/003/2138254-32-5.png)
N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide structure
|
Common Name | N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 2138254-32-5 | Molecular Weight | 218.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H18N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H18N2O2S |
|---|---|
| Molecular Weight | 218.32 |
| InChIKey | JTIHBWUZZVRKNW-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)NCC1CC2CCC1N2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide? |
| A: CAS number of N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide is 2138254-32-5. |
| Q: What is the SMILES notation of N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide? |
| A: SMILES notation of N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide is CCS(=O)(=O)NCC1CC2CCC1N2. |
| Q: What is the molecular formula of N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide? |
| A: Molecular formula of N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide is C9H18N2O2S. |
| Q: What is the InChIKey of N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide? |
| A: InChIKey of N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide is JTIHBWUZZVRKNW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide? |
| A: Molecular weight of N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide is 218.32. |
| Q: What is the Chinese name of 2138254-32-5? |
| A: Chinese name of 2138254-32-5 is 2138254-32-5. |
| Q: What is the English name of N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide? |
| A: The English name of N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide is N-({7-azabicyclo[2.2.1]heptan-2-yl}methyl)ethane-1-sulfonamide. |