3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole
Modify Date: 2026-07-03 20:27:10
3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole structure
|
Common Name | 3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole | ||
|---|---|---|---|---|
| CAS Number | 2138259-93-3 | Molecular Weight | 206.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H22N2 |
|---|---|
| Molecular Weight | 206.33 |
| InChIKey | OIRKWGODNNFMBW-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1CCc2n[nH]c(C)c2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole? |
| A: Molecular weight of 3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole is 206.33. |
| Q: What is the CAS number of 3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole? |
| A: CAS number of 3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole is 2138259-93-3. |
| Q: What is the SMILES notation of 3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole? |
| A: SMILES notation of 3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole is CCC(C)(C)C1CCc2n[nH]c(C)c2C1. |
| Q: What is the InChIKey of 3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole? |
| A: InChIKey of 3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole is OIRKWGODNNFMBW-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole? |
| A: Molecular formula of 3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole is C13H22N2. |
| Q: What is the English name of 3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole? |
| A: The English name of 3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole is 3-methyl-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-2H-indazole. |
| Q: What is the Chinese name of 2138259-93-3? |
| A: Chinese name of 2138259-93-3 is 2138259-93-3. |