N4-methyl-8-propylquinoline-3,4-diamine
Modify Date: 2026-07-06 21:47:07
N4-methyl-8-propylquinoline-3,4-diamine structure
|
Common Name | N4-methyl-8-propylquinoline-3,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 2138274-58-3 | Molecular Weight | 215.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N4-methyl-8-propylquinoline-3,4-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17N3 |
|---|---|
| Molecular Weight | 215.29 |
| InChIKey | PNFMNHFOAKKORA-UHFFFAOYSA-N |
| SMILES | CCCc1cccc2c(NC)c(N)cnc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2138274-58-3? |
| A: Chinese name of 2138274-58-3 is 2138274-58-3. |
| Q: What is the SMILES notation of N4-methyl-8-propylquinoline-3,4-diamine? |
| A: SMILES notation of N4-methyl-8-propylquinoline-3,4-diamine is CCCc1cccc2c(NC)c(N)cnc12. |
| Q: What is the InChIKey of N4-methyl-8-propylquinoline-3,4-diamine? |
| A: InChIKey of N4-methyl-8-propylquinoline-3,4-diamine is PNFMNHFOAKKORA-UHFFFAOYSA-N. |
| Q: What is the CAS number of N4-methyl-8-propylquinoline-3,4-diamine? |
| A: CAS number of N4-methyl-8-propylquinoline-3,4-diamine is 2138274-58-3. |
| Q: What is the molecular weight of N4-methyl-8-propylquinoline-3,4-diamine? |
| A: Molecular weight of N4-methyl-8-propylquinoline-3,4-diamine is 215.29. |
| Q: What is the English name of N4-methyl-8-propylquinoline-3,4-diamine? |
| A: The English name of N4-methyl-8-propylquinoline-3,4-diamine is N4-methyl-8-propylquinoline-3,4-diamine. |
| Q: What is the molecular formula of N4-methyl-8-propylquinoline-3,4-diamine? |
| A: Molecular formula of N4-methyl-8-propylquinoline-3,4-diamine is C13H17N3. |