4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one
Modify Date: 2026-07-03 23:37:11
4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one structure
|
Common Name | 4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 2138275-47-3 | Molecular Weight | 225.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9ClFNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9ClFNO |
|---|---|
| Molecular Weight | 225.64 |
| InChIKey | GAOHVSIRAAKJHT-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)c2cc(F)ccc2n(C)c1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one? |
| A: CAS number of 4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one is 2138275-47-3. |
| Q: What is the SMILES notation of 4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one? |
| A: SMILES notation of 4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one is Cc1c(Cl)c2cc(F)ccc2n(C)c1=O. |
| Q: What is the molecular weight of 4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one? |
| A: Molecular weight of 4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one is 225.64. |
| Q: What is the Chinese name of 2138275-47-3? |
| A: Chinese name of 2138275-47-3 is 2138275-47-3. |
| Q: What is the InChIKey of 4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one? |
| A: InChIKey of 4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one is GAOHVSIRAAKJHT-UHFFFAOYSA-N. |
| Q: What is the English name of 4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one? |
| A: The English name of 4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one is 4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one. |
| Q: What is the molecular formula of 4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one? |
| A: Molecular formula of 4-Chloro-6-fluoro-1,3-dimethyl-1,2-dihydroquinolin-2-one is C11H9ClFNO. |