5,7-dibromo-N4-methylquinoline-3,4-diamine
Modify Date: 2025-08-24 21:10:56
5,7-dibromo-N4-methylquinoline-3,4-diamine structure
|
Common Name | 5,7-dibromo-N4-methylquinoline-3,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 2138333-13-6 | Molecular Weight | 331.01 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9Br2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,7-dibromo-N4-methylquinoline-3,4-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9Br2N3 |
|---|---|
| Molecular Weight | 331.01 |
| InChIKey | OIBDCRZTBANPBH-UHFFFAOYSA-N |
| SMILES | CNc1c(N)cnc2cc(Br)cc(Br)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5,7-dibromo-N4-methylquinoline-3,4-diamine? |
| A: CAS number of 5,7-dibromo-N4-methylquinoline-3,4-diamine is 2138333-13-6. |
| Q: What is the molecular formula of 5,7-dibromo-N4-methylquinoline-3,4-diamine? |
| A: Molecular formula of 5,7-dibromo-N4-methylquinoline-3,4-diamine is C10H9Br2N3. |
| Q: What is the InChIKey of 5,7-dibromo-N4-methylquinoline-3,4-diamine? |
| A: InChIKey of 5,7-dibromo-N4-methylquinoline-3,4-diamine is OIBDCRZTBANPBH-UHFFFAOYSA-N. |
| Q: What is the English name of 5,7-dibromo-N4-methylquinoline-3,4-diamine? |
| A: The English name of 5,7-dibromo-N4-methylquinoline-3,4-diamine is 5,7-dibromo-N4-methylquinoline-3,4-diamine. |
| Q: What is the SMILES notation of 5,7-dibromo-N4-methylquinoline-3,4-diamine? |
| A: SMILES notation of 5,7-dibromo-N4-methylquinoline-3,4-diamine is CNc1c(N)cnc2cc(Br)cc(Br)c12. |
| Q: What is the molecular weight of 5,7-dibromo-N4-methylquinoline-3,4-diamine? |
| A: Molecular weight of 5,7-dibromo-N4-methylquinoline-3,4-diamine is 331.01. |
| Q: What is the Chinese name of 2138333-13-6? |
| A: Chinese name of 2138333-13-6 is 2138333-13-6. |