5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine
Modify Date: 2025-09-09 18:32:43
![5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine Structure](https://www.chemsrc.com/extcaspic/309/2138348-04-4.png)
5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine structure
|
Common Name | 5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 2138348-04-4 | Molecular Weight | 233.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15N3S |
|---|---|
| Molecular Weight | 233.33 |
| InChIKey | ZDUVOMZVARLHFL-UHFFFAOYSA-N |
| SMILES | Nc1ncnc2scc(C3CCCCC3)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine? |
| A: SMILES notation of 5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine is Nc1ncnc2scc(C3CCCCC3)c12. |
| Q: What is the CAS number of 5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine? |
| A: CAS number of 5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine is 2138348-04-4. |
| Q: What is the InChIKey of 5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine? |
| A: InChIKey of 5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine is ZDUVOMZVARLHFL-UHFFFAOYSA-N. |
| Q: What is the English name of 5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine? |
| A: The English name of 5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine is 5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine. |
| Q: What is the Chinese name of 2138348-04-4? |
| A: Chinese name of 2138348-04-4 is 2138348-04-4. |
| Q: What is the molecular formula of 5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine? |
| A: Molecular formula of 5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine is C12H15N3S. |
| Q: What is the molecular weight of 5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine? |
| A: Molecular weight of 5-Cyclohexylthieno[2,3-d]pyrimidin-4-amine is 233.33. |