1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea
Modify Date: 2025-09-17 19:01:53
![1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea Structure](https://www.chemsrc.com/extcaspic/303/2138356-50-8.png)
1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea structure
|
Common Name | 1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea | ||
|---|---|---|---|---|
| CAS Number | 2138356-50-8 | Molecular Weight | 263.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12F3N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H12F3N5O |
|---|---|
| Molecular Weight | 263.22 |
| InChIKey | QMGFKFIVCSGNNL-UHFFFAOYSA-N |
| SMILES | O=C(NCC(F)(F)F)Nc1ccnn1C1CNC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea? |
| A: InChIKey of 1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea is QMGFKFIVCSGNNL-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea? |
| A: Molecular formula of 1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea is C9H12F3N5O. |
| Q: What is the English name of 1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea? |
| A: The English name of 1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea is 1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea. |
| Q: What is the SMILES notation of 1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea? |
| A: SMILES notation of 1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea is O=C(NCC(F)(F)F)Nc1ccnn1C1CNC1. |
| Q: What is the CAS number of 1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea? |
| A: CAS number of 1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea is 2138356-50-8. |
| Q: What is the Chinese name of 2138356-50-8? |
| A: Chinese name of 2138356-50-8 is 2138356-50-8. |
| Q: What is the molecular weight of 1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea? |
| A: Molecular weight of 1-[1-(azetidin-3-yl)-1H-pyrazol-5-yl]-3-(2,2,2-trifluoroethyl)urea is 263.22. |