4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid
Modify Date: 2026-09-27 21:13:28
![4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid Structure](https://www.chemsrc.com/extcaspic/302/2138357-27-2.png)
4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid structure
|
Common Name | 4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2138357-27-2 | Molecular Weight | 299.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H21N3O3S |
|---|---|
| Molecular Weight | 299.39 |
| InChIKey | IGNWXYGHNPHLSL-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCc1cn(CCOC2CCSCC2)nn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid? |
| A: SMILES notation of 4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid is O=C(O)CCCc1cn(CCOC2CCSCC2)nn1. |
| Q: What is the Chinese name of 2138357-27-2? |
| A: Chinese name of 2138357-27-2 is 2138357-27-2. |
| Q: What is the molecular formula of 4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid? |
| A: Molecular formula of 4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid is C13H21N3O3S. |
| Q: What is the molecular weight of 4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid? |
| A: Molecular weight of 4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid is 299.39. |
| Q: What is the CAS number of 4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid? |
| A: CAS number of 4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid is 2138357-27-2. |
| Q: What is the InChIKey of 4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid? |
| A: InChIKey of 4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid is IGNWXYGHNPHLSL-UHFFFAOYSA-N. |
| Q: What is the English name of 4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid? |
| A: The English name of 4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid is 4-{1-[2-(thian-4-yloxy)ethyl]-1H-1,2,3-triazol-4-yl}butanoic acid. |