8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol
Modify Date: 2026-09-29 07:33:18
8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol structure
|
Common Name | 8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol | ||
|---|---|---|---|---|
| CAS Number | 2138366-65-9 | Molecular Weight | 294.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H16BrNO |
|---|---|
| Molecular Weight | 294.19 |
| InChIKey | MTMUKXWWAZUAKS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Cc1nc2c(Br)cccc2cc1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol? |
| A: SMILES notation of 8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol is CC(C)(C)Cc1nc2c(Br)cccc2cc1O. |
| Q: What is the molecular formula of 8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol? |
| A: Molecular formula of 8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol is C14H16BrNO. |
| Q: What is the CAS number of 8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol? |
| A: CAS number of 8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol is 2138366-65-9. |
| Q: What is the molecular weight of 8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol? |
| A: Molecular weight of 8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol is 294.19. |
| Q: What is the English name of 8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol? |
| A: The English name of 8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol is 8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol. |
| Q: What is the Chinese name of 2138366-65-9? |
| A: Chinese name of 2138366-65-9 is 2138366-65-9. |
| Q: What is the InChIKey of 8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol? |
| A: InChIKey of 8-bromo-2-(2,2-dimethylpropyl)quinolin-3-ol is MTMUKXWWAZUAKS-UHFFFAOYSA-N. |