5-fluoro-N4,6-dimethylquinoline-3,4-diamine
Modify Date: 2026-08-08 12:54:47
5-fluoro-N4,6-dimethylquinoline-3,4-diamine structure
|
Common Name | 5-fluoro-N4,6-dimethylquinoline-3,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 2138369-87-4 | Molecular Weight | 205.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12FN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-fluoro-N4,6-dimethylquinoline-3,4-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12FN3 |
|---|---|
| Molecular Weight | 205.23 |
| InChIKey | POIHCHUNEOPIGF-UHFFFAOYSA-N |
| SMILES | CNc1c(N)cnc2ccc(C)c(F)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-fluoro-N4,6-dimethylquinoline-3,4-diamine? |
| A: InChIKey of 5-fluoro-N4,6-dimethylquinoline-3,4-diamine is POIHCHUNEOPIGF-UHFFFAOYSA-N. |
| Q: What is the English name of 5-fluoro-N4,6-dimethylquinoline-3,4-diamine? |
| A: The English name of 5-fluoro-N4,6-dimethylquinoline-3,4-diamine is 5-fluoro-N4,6-dimethylquinoline-3,4-diamine. |
| Q: What is the Chinese name of 2138369-87-4? |
| A: Chinese name of 2138369-87-4 is 2138369-87-4. |
| Q: What is the molecular weight of 5-fluoro-N4,6-dimethylquinoline-3,4-diamine? |
| A: Molecular weight of 5-fluoro-N4,6-dimethylquinoline-3,4-diamine is 205.23. |
| Q: What is the CAS number of 5-fluoro-N4,6-dimethylquinoline-3,4-diamine? |
| A: CAS number of 5-fluoro-N4,6-dimethylquinoline-3,4-diamine is 2138369-87-4. |
| Q: What is the molecular formula of 5-fluoro-N4,6-dimethylquinoline-3,4-diamine? |
| A: Molecular formula of 5-fluoro-N4,6-dimethylquinoline-3,4-diamine is C11H12FN3. |
| Q: What is the SMILES notation of 5-fluoro-N4,6-dimethylquinoline-3,4-diamine? |
| A: SMILES notation of 5-fluoro-N4,6-dimethylquinoline-3,4-diamine is CNc1c(N)cnc2ccc(C)c(F)c12. |