3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid
Modify Date: 2026-07-22 19:03:06
![3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid Structure](https://www.chemsrc.com/extcaspic/411/2138436-15-2.png)
3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid structure
|
Common Name | 3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2138436-15-2 | Molecular Weight | 323.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H21NO4S |
|---|---|
| Molecular Weight | 323.4 |
| InChIKey | YOLAKIVAXVFVNZ-UHFFFAOYSA-N |
| SMILES | O=C(NCC(CC1CCSC1)C(=O)O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid? |
| A: CAS number of 3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid is 2138436-15-2. |
| Q: What is the molecular formula of 3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid? |
| A: Molecular formula of 3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid is C16H21NO4S. |
| Q: What is the Chinese name of 2138436-15-2? |
| A: Chinese name of 2138436-15-2 is 2138436-15-2. |
| Q: What is the InChIKey of 3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid? |
| A: InChIKey of 3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid is YOLAKIVAXVFVNZ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid? |
| A: Molecular weight of 3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid is 323.4. |
| Q: What is the English name of 3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid? |
| A: The English name of 3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid is 3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid. |
| Q: What is the SMILES notation of 3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid? |
| A: SMILES notation of 3-{[(Benzyloxy)carbonyl]amino}-2-[(thiolan-3-yl)methyl]propanoic acid is O=C(NCC(CC1CCSC1)C(=O)O)OCc1ccccc1. |