4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane
Modify Date: 2026-07-27 09:47:34
4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane structure
|
Common Name | 4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane | ||
|---|---|---|---|---|
| CAS Number | 2138511-57-4 | Molecular Weight | 247.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H23Br | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H23Br |
|---|---|
| Molecular Weight | 247.21 |
| InChIKey | RSOVPMJZWAXWTL-UHFFFAOYSA-N |
| SMILES | CC1(C)CCC(C(C)(C)CBr)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane? |
| A: SMILES notation of 4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane is CC1(C)CCC(C(C)(C)CBr)CC1. |
| Q: What is the CAS number of 4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane? |
| A: CAS number of 4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane is 2138511-57-4. |
| Q: What is the English name of 4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane? |
| A: The English name of 4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane is 4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane. |
| Q: What is the molecular formula of 4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane? |
| A: Molecular formula of 4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane is C12H23Br. |
| Q: What is the molecular weight of 4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane? |
| A: Molecular weight of 4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane is 247.21. |
| Q: What is the Chinese name of 2138511-57-4? |
| A: Chinese name of 2138511-57-4 is 2138511-57-4. |
| Q: What is the InChIKey of 4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane? |
| A: InChIKey of 4-(1-Bromo-2-methylpropan-2-yl)-1,1-dimethylcyclohexane is RSOVPMJZWAXWTL-UHFFFAOYSA-N. |