methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate
Modify Date: 2026-07-21 11:01:06
![methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate Structure](https://www.chemsrc.com/extcaspic/053/2138519-98-7.png)
methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate structure
|
Common Name | methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2138519-98-7 | Molecular Weight | 343.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H17N3O5 |
|---|---|
| Molecular Weight | 343.33 |
| InChIKey | RPKHAOJAJZSNNP-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(Cn2cc(-c3ccc(OC)c(OC)c3)nn2)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2138519-98-7? |
| A: Chinese name of 2138519-98-7 is 2138519-98-7. |
| Q: What is the SMILES notation of methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate? |
| A: SMILES notation of methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate is COC(=O)c1ccc(Cn2cc(-c3ccc(OC)c(OC)c3)nn2)o1. |
| Q: What is the English name of methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate? |
| A: The English name of methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate is methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate. |
| Q: What is the molecular formula of methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate? |
| A: Molecular formula of methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate is C17H17N3O5. |
| Q: What is the molecular weight of methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate? |
| A: Molecular weight of methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate is 343.33. |
| Q: What is the InChIKey of methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate? |
| A: InChIKey of methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate is RPKHAOJAJZSNNP-UHFFFAOYSA-N. |
| Q: What is the CAS number of methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate? |
| A: CAS number of methyl 5-{[4-(3,4-dimethoxyphenyl)-1H-1,2,3-triazol-1-yl]methyl}furan-2-carboxylate is 2138519-98-7. |