1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide
Modify Date: 2026-07-26 18:35:23
![1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide Structure](https://www.chemsrc.com/extcaspic/346/2138556-63-3.png)
1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide structure
|
Common Name | 1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 2138556-63-3 | Molecular Weight | 290.81 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19ClN2O2S |
|---|---|
| Molecular Weight | 290.81 |
| InChIKey | SKCRGBAKJLFAIN-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1ccc(CN(C)S(=O)(=O)CCl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2138556-63-3? |
| A: Chinese name of 2138556-63-3 is 2138556-63-3. |
| Q: What is the SMILES notation of 1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide? |
| A: SMILES notation of 1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide is CN(C)Cc1ccc(CN(C)S(=O)(=O)CCl)cc1. |
| Q: What is the English name of 1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide? |
| A: The English name of 1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide is 1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide. |
| Q: What is the CAS number of 1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide? |
| A: CAS number of 1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide is 2138556-63-3. |
| Q: What is the InChIKey of 1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide? |
| A: InChIKey of 1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide is SKCRGBAKJLFAIN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide? |
| A: Molecular weight of 1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide is 290.81. |
| Q: What is the molecular formula of 1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide? |
| A: Molecular formula of 1-chloro-N-({4-[(dimethylamino)methyl]phenyl}methyl)-N-methylmethanesulfonamide is C12H19ClN2O2S. |