propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate
Modify Date: 2026-09-13 17:40:20
![propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate Structure](https://www.chemsrc.com/extcaspic/294/2138562-93-1.png)
propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate structure
|
Common Name | propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2138562-93-1 | Molecular Weight | 250.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H22N2O2 |
|---|---|
| Molecular Weight | 250.34 |
| InChIKey | CEHQMQAPJTZKDZ-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)OC(C)C)cnn1CC1CC(C)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2138562-93-1? |
| A: Chinese name of 2138562-93-1 is 2138562-93-1. |
| Q: What is the InChIKey of propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: InChIKey of propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is CEHQMQAPJTZKDZ-UHFFFAOYSA-N. |
| Q: What is the CAS number of propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: CAS number of propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is 2138562-93-1. |
| Q: What is the English name of propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: The English name of propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate. |
| Q: What is the molecular weight of propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: Molecular weight of propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is 250.34. |
| Q: What is the SMILES notation of propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: SMILES notation of propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is Cc1c(C(=O)OC(C)C)cnn1CC1CC(C)C1. |
| Q: What is the molecular formula of propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: Molecular formula of propan-2-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is C14H22N2O2. |