3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid
Modify Date: 2025-08-28 13:26:50
3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid structure
|
Common Name | 3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2138564-09-5 | Molecular Weight | 297.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8BrF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8BrF3O2 |
|---|---|
| Molecular Weight | 297.07 |
| InChIKey | HFQRCEIZSNZDNO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Br)c(F)c1CC(F)(F)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid? |
| A: The English name of 3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid is 3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid. |
| Q: What is the InChIKey of 3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid? |
| A: InChIKey of 3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid is HFQRCEIZSNZDNO-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2138564-09-5? |
| A: Chinese name of 2138564-09-5 is 2138564-09-5. |
| Q: What is the CAS number of 3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid? |
| A: CAS number of 3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid is 2138564-09-5. |
| Q: What is the molecular formula of 3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid? |
| A: Molecular formula of 3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid is C10H8BrF3O2. |
| Q: What is the SMILES notation of 3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid? |
| A: SMILES notation of 3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid is Cc1ccc(Br)c(F)c1CC(F)(F)C(=O)O. |
| Q: What is the molecular weight of 3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid? |
| A: Molecular weight of 3-(3-Bromo-2-fluoro-6-methylphenyl)-2,2-difluoropropanoic acid is 297.07. |