2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid
Modify Date: 2025-09-18 18:31:52
![2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/354/2138564-11-9.png)
2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid structure
|
Common Name | 2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2138564-11-9 | Molecular Weight | 277.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15N3O2S |
|---|---|
| Molecular Weight | 277.34 |
| InChIKey | QDFIGENYFWFADT-UHFFFAOYSA-N |
| SMILES | CSC(C)CNc1ncc2c(C(=O)O)cccc2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid? |
| A: CAS number of 2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid is 2138564-11-9. |
| Q: What is the molecular weight of 2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid? |
| A: Molecular weight of 2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid is 277.34. |
| Q: What is the Chinese name of 2138564-11-9? |
| A: Chinese name of 2138564-11-9 is 2138564-11-9. |
| Q: What is the SMILES notation of 2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid? |
| A: SMILES notation of 2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid is CSC(C)CNc1ncc2c(C(=O)O)cccc2n1. |
| Q: What is the molecular formula of 2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid? |
| A: Molecular formula of 2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid is C13H15N3O2S. |
| Q: What is the English name of 2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid? |
| A: The English name of 2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid is 2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid. |
| Q: What is the InChIKey of 2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid? |
| A: InChIKey of 2-{[2-(Methylsulfanyl)propyl]amino}quinazoline-5-carboxylic acid is QDFIGENYFWFADT-UHFFFAOYSA-N. |