3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid
Modify Date: 2026-06-30 18:57:34
3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid structure
|
Common Name | 3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2138564-21-1 | Molecular Weight | 228.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10F2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10F2O3 |
|---|---|
| Molecular Weight | 228.19 |
| InChIKey | KGZVPPJBOHYKDU-UHFFFAOYSA-N |
| SMILES | O=C(O)C(F)(F)Cc1ccc2c(c1)COC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2138564-21-1? |
| A: Chinese name of 2138564-21-1 is 2138564-21-1. |
| Q: What is the CAS number of 3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid? |
| A: CAS number of 3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid is 2138564-21-1. |
| Q: What is the InChIKey of 3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid? |
| A: InChIKey of 3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid is KGZVPPJBOHYKDU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid? |
| A: Molecular weight of 3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid is 228.19. |
| Q: What is the English name of 3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid? |
| A: The English name of 3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid is 3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid. |
| Q: What is the SMILES notation of 3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid? |
| A: SMILES notation of 3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid is O=C(O)C(F)(F)Cc1ccc2c(c1)COC2. |
| Q: What is the molecular formula of 3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid? |
| A: Molecular formula of 3-(1,3-Dihydro-2-benzofuran-5-yl)-2,2-difluoropropanoic acid is C11H10F2O3. |