5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine
Modify Date: 2025-09-02 12:07:36
![5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine Structure](https://www.chemsrc.com/extcaspic/116/2138564-39-1.png)
5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine structure
|
Common Name | 5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine | ||
|---|---|---|---|---|
| CAS Number | 2138564-39-1 | Molecular Weight | 222.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19FN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19FN2 |
|---|---|
| Molecular Weight | 222.30 |
| InChIKey | PJXLLPULBYAVTD-UHFFFAOYSA-N |
| SMILES | CC1CC(C)CN(Cc2ccc(F)nc2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine? |
| A: The English name of 5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine is 5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine. |
| Q: What is the molecular weight of 5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine? |
| A: Molecular weight of 5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine is 222.30. |
| Q: What is the InChIKey of 5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine? |
| A: InChIKey of 5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine is PJXLLPULBYAVTD-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2138564-39-1? |
| A: Chinese name of 2138564-39-1 is 2138564-39-1. |
| Q: What is the molecular formula of 5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine? |
| A: Molecular formula of 5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine is C13H19FN2. |
| Q: What is the CAS number of 5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine? |
| A: CAS number of 5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine is 2138564-39-1. |
| Q: What is the SMILES notation of 5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine? |
| A: SMILES notation of 5-[(3,5-Dimethylpiperidin-1-yl)methyl]-2-fluoropyridine is CC1CC(C)CN(Cc2ccc(F)nc2)C1. |