prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate
Modify Date: 2025-10-04 09:11:44
![prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate Structure](https://www.chemsrc.com/extcaspic/261/2138564-40-4.png)
prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate structure
|
Common Name | prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2138564-40-4 | Molecular Weight | 248.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H20N2O2 |
|---|---|
| Molecular Weight | 248.32 |
| InChIKey | SCUGNJBICXMVQI-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)c1cnn(CC2CC(C)C2)c1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: CAS number of prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is 2138564-40-4. |
| Q: What is the English name of prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: The English name of prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate. |
| Q: What is the molecular formula of prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: Molecular formula of prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is C14H20N2O2. |
| Q: What is the molecular weight of prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: Molecular weight of prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is 248.32. |
| Q: What is the InChIKey of prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: InChIKey of prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is SCUGNJBICXMVQI-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: SMILES notation of prop-2-en-1-yl 5-methyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is C=CCOC(=O)c1cnn(CC2CC(C)C2)c1C. |
| Q: What is the Chinese name of 2138564-40-4? |
| A: Chinese name of 2138564-40-4 is 2138564-40-4. |