methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate
Modify Date: 2026-08-26 18:28:15
![methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate Structure](https://www.chemsrc.com/extcaspic/109/2138564-44-8.png)
methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate structure
|
Common Name | methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2138564-44-8 | Molecular Weight | 236.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H20N2O2 |
|---|---|
| Molecular Weight | 236.31 |
| InChIKey | XUOGZYWRCOHQPG-UHFFFAOYSA-N |
| SMILES | CCc1c(C(=O)OC)cnn1CC1CC(C)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: Molecular weight of methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is 236.31. |
| Q: What is the CAS number of methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: CAS number of methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is 2138564-44-8. |
| Q: What is the molecular formula of methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: Molecular formula of methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is C13H20N2O2. |
| Q: What is the Chinese name of 2138564-44-8? |
| A: Chinese name of 2138564-44-8 is 2138564-44-8. |
| Q: What is the English name of methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: The English name of methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate. |
| Q: What is the SMILES notation of methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: SMILES notation of methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is CCc1c(C(=O)OC)cnn1CC1CC(C)C1. |
| Q: What is the InChIKey of methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate? |
| A: InChIKey of methyl 5-ethyl-1-[(3-methylcyclobutyl)methyl]-1H-pyrazole-4-carboxylate is XUOGZYWRCOHQPG-UHFFFAOYSA-N. |