2,4-Dimethoxy-3-phenylaniline
Modify Date: 2026-08-28 18:48:12
2,4-Dimethoxy-3-phenylaniline structure
|
Common Name | 2,4-Dimethoxy-3-phenylaniline | ||
|---|---|---|---|---|
| CAS Number | 2138564-50-6 | Molecular Weight | 229.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-Dimethoxy-3-phenylaniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15NO2 |
|---|---|
| Molecular Weight | 229.27 |
| InChIKey | MBPCROJGGRAZLP-UHFFFAOYSA-N |
| SMILES | COc1ccc(N)c(OC)c1-c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,4-Dimethoxy-3-phenylaniline? |
| A: InChIKey of 2,4-Dimethoxy-3-phenylaniline is MBPCROJGGRAZLP-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,4-Dimethoxy-3-phenylaniline? |
| A: CAS number of 2,4-Dimethoxy-3-phenylaniline is 2138564-50-6. |
| Q: What is the English name of 2,4-Dimethoxy-3-phenylaniline? |
| A: The English name of 2,4-Dimethoxy-3-phenylaniline is 2,4-Dimethoxy-3-phenylaniline. |
| Q: What is the molecular formula of 2,4-Dimethoxy-3-phenylaniline? |
| A: Molecular formula of 2,4-Dimethoxy-3-phenylaniline is C14H15NO2. |
| Q: What is the SMILES notation of 2,4-Dimethoxy-3-phenylaniline? |
| A: SMILES notation of 2,4-Dimethoxy-3-phenylaniline is COc1ccc(N)c(OC)c1-c1ccccc1. |
| Q: What is the molecular weight of 2,4-Dimethoxy-3-phenylaniline? |
| A: Molecular weight of 2,4-Dimethoxy-3-phenylaniline is 229.27. |
| Q: What is the Chinese name of 2138564-50-6? |
| A: Chinese name of 2138564-50-6 is 2138564-50-6. |