[(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride
Modify Date: 2026-09-20 10:15:26
![[(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride Structure](https://www.chemsrc.com/extcaspic/240/2138564-58-4.png)
[(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride structure
|
Common Name | [(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2138564-58-4 | Molecular Weight | 217.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H11ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H11ClF3NO |
|---|---|
| Molecular Weight | 217.61 |
| InChIKey | GKUOMWWRLIAVEN-KGZKBUQUSA-N |
| SMILES | Cl.OCC12CNCC1(C(F)(F)F)C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of [(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride? |
| A: Molecular formula of [(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride is C7H11ClF3NO. |
| Q: What is the molecular weight of [(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride? |
| A: Molecular weight of [(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride is 217.61. |
| Q: What is the CAS number of [(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride? |
| A: CAS number of [(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride is 2138564-58-4. |
| Q: What is the SMILES notation of [(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride? |
| A: SMILES notation of [(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride is Cl.OCC12CNCC1(C(F)(F)F)C2. |
| Q: What is the InChIKey of [(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride? |
| A: InChIKey of [(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride is GKUOMWWRLIAVEN-KGZKBUQUSA-N. |
| Q: What is the English name of [(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride? |
| A: The English name of [(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride is [(1R,5S)-5-(Trifluoromethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methanol;hydrochloride. |
| Q: What is the Chinese name of 2138564-58-4? |
| A: Chinese name of 2138564-58-4 is 2138564-58-4. |