tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate
Modify Date: 2025-09-18 19:30:47
![tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate Structure](https://www.chemsrc.com/extcaspic/185/2138564-64-2.png)
tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate structure
|
Common Name | tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 2138564-64-2 | Molecular Weight | 380.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H30BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H30BrNO4 |
|---|---|
| Molecular Weight | 380.32 |
| InChIKey | HQSRJLVCQJHBAX-UHFFFAOYSA-N |
| SMILES | CCN(CC(C)(CBr)OC1COCC1C)C(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate? |
| A: SMILES notation of tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate is CCN(CC(C)(CBr)OC1COCC1C)C(=O)OC(C)(C)C. |
| Q: What is the molecular formula of tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate? |
| A: Molecular formula of tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate is C16H30BrNO4. |
| Q: What is the InChIKey of tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate? |
| A: InChIKey of tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate is HQSRJLVCQJHBAX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2138564-64-2? |
| A: Chinese name of 2138564-64-2 is 2138564-64-2. |
| Q: What is the molecular weight of tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate? |
| A: Molecular weight of tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate is 380.32. |
| Q: What is the English name of tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate? |
| A: The English name of tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate is tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate. |
| Q: What is the CAS number of tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate? |
| A: CAS number of tert-butyl N-{3-bromo-2-methyl-2-[(4-methyloxolan-3-yl)oxy]propyl}-N-ethylcarbamate is 2138564-64-2. |