1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride
Modify Date: 2025-11-02 14:44:30
1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride structure
|
Common Name | 1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 2138564-81-3 | Molecular Weight | 210.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H15ClO2S |
|---|---|
| Molecular Weight | 210.72 |
| InChIKey | BBPDASOFRQGUIN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC1(S(=O)(=O)Cl)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride? |
| A: SMILES notation of 1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride is CC(C)(C)CC1(S(=O)(=O)Cl)CC1. |
| Q: What is the molecular formula of 1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride? |
| A: Molecular formula of 1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride is C8H15ClO2S. |
| Q: What is the Chinese name of 2138564-81-3? |
| A: Chinese name of 2138564-81-3 is 2138564-81-3. |
| Q: What is the molecular weight of 1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride? |
| A: Molecular weight of 1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride is 210.72. |
| Q: What is the English name of 1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride? |
| A: The English name of 1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride is 1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride. |
| Q: What is the InChIKey of 1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride? |
| A: InChIKey of 1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride is BBPDASOFRQGUIN-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride? |
| A: CAS number of 1-(2,2-Dimethylpropyl)cyclopropane-1-sulfonyl chloride is 2138564-81-3. |