5-(4-Aminophenyl)-2,3,4-trifluoroaniline
Modify Date: 2025-09-02 16:31:58
5-(4-Aminophenyl)-2,3,4-trifluoroaniline structure
|
Common Name | 5-(4-Aminophenyl)-2,3,4-trifluoroaniline | ||
|---|---|---|---|---|
| CAS Number | 2138564-83-5 | Molecular Weight | 238.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(4-Aminophenyl)-2,3,4-trifluoroaniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H9F3N2 |
|---|---|
| Molecular Weight | 238.21 |
| InChIKey | DDRJOZMWBHHWSI-UHFFFAOYSA-N |
| SMILES | Nc1ccc(-c2cc(N)c(F)c(F)c2F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5-(4-Aminophenyl)-2,3,4-trifluoroaniline? |
| A: CAS number of 5-(4-Aminophenyl)-2,3,4-trifluoroaniline is 2138564-83-5. |
| Q: What is the InChIKey of 5-(4-Aminophenyl)-2,3,4-trifluoroaniline? |
| A: InChIKey of 5-(4-Aminophenyl)-2,3,4-trifluoroaniline is DDRJOZMWBHHWSI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-(4-Aminophenyl)-2,3,4-trifluoroaniline? |
| A: Molecular formula of 5-(4-Aminophenyl)-2,3,4-trifluoroaniline is C12H9F3N2. |
| Q: What is the English name of 5-(4-Aminophenyl)-2,3,4-trifluoroaniline? |
| A: The English name of 5-(4-Aminophenyl)-2,3,4-trifluoroaniline is 5-(4-Aminophenyl)-2,3,4-trifluoroaniline. |
| Q: What is the SMILES notation of 5-(4-Aminophenyl)-2,3,4-trifluoroaniline? |
| A: SMILES notation of 5-(4-Aminophenyl)-2,3,4-trifluoroaniline is Nc1ccc(-c2cc(N)c(F)c(F)c2F)cc1. |
| Q: What is the Chinese name of 2138564-83-5? |
| A: Chinese name of 2138564-83-5 is 2138564-83-5. |
| Q: What is the molecular weight of 5-(4-Aminophenyl)-2,3,4-trifluoroaniline? |
| A: Molecular weight of 5-(4-Aminophenyl)-2,3,4-trifluoroaniline is 238.21. |