2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole
Modify Date: 2025-09-22 21:21:21
![2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole Structure](https://www.chemsrc.com/extcaspic/193/2138575-55-8.png)
2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole structure
|
Common Name | 2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole | ||
|---|---|---|---|---|
| CAS Number | 2138575-55-8 | Molecular Weight | 289.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17BrN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H17BrN2S |
|---|---|
| Molecular Weight | 289.24 |
| InChIKey | JCVRHYARPSTYNI-UHFFFAOYSA-N |
| SMILES | Cc1nnc(CC2CC(Br)CCC2C)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole? |
| A: Molecular formula of 2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole is C11H17BrN2S. |
| Q: What is the CAS number of 2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole? |
| A: CAS number of 2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole is 2138575-55-8. |
| Q: What is the SMILES notation of 2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole? |
| A: SMILES notation of 2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole is Cc1nnc(CC2CC(Br)CCC2C)s1. |
| Q: What is the InChIKey of 2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole? |
| A: InChIKey of 2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole is JCVRHYARPSTYNI-UHFFFAOYSA-N. |
| Q: What is the English name of 2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole? |
| A: The English name of 2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole is 2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole. |
| Q: What is the molecular weight of 2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole? |
| A: Molecular weight of 2-[(5-Bromo-2-methylcyclohexyl)methyl]-5-methyl-1,3,4-thiadiazole is 289.24. |
| Q: What is the Chinese name of 2138575-55-8? |
| A: Chinese name of 2138575-55-8 is 2138575-55-8. |