7-chloro-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine structure
|
Common Name | 7-chloro-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine | ||
|---|---|---|---|---|
| CAS Number | 213896-64-1 | Molecular Weight | 235.63000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6ClN5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-chloro-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H6ClN5O |
|---|---|
| Molecular Weight | 235.63000 |
| Exact Mass | 235.02600 |
| PSA | 82.97000 |
| LogP | 1.55000 |
| InChIKey | ALFSSSOPSVBKPW-UHFFFAOYSA-N |
| SMILES | Nc1nc(Cl)cc2nc(-c3ccco3)nn12 |
|
~28%
7-chloro-2-(fur... CAS#:213896-64-1 |
| Literature: Matasi, Julius J.; Caldwell, John P.; Zhang, Hongtao; Fawzi, Ahmad; Cohen-Williams, Mary E.; Varty, Geoffrey B.; Tulshian, Deen B. Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 16 p. 3670 - 3674 |
|
~%
7-chloro-2-(fur... CAS#:213896-64-1 |
| Literature: Matasi, Julius J.; Caldwell, John P.; Zhang, Hongtao; Fawzi, Ahmad; Cohen-Williams, Mary E.; Varty, Geoffrey B.; Tulshian, Deen B. Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 16 p. 3670 - 3674 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| MFCD26391812 |